CAS 2195351-01-8 is the registry number for Benzyl ((1S,2R)-3,3-difluoro-2-hydroxycyclohexyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-[(1S,2R)-3,3-difluoro-2-hydroxycyclohexyl]carbamate (CAS 2195351-01-8) is a chemical compound with the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. IUPAC name: benzyl N-[(1S,2R)-3,3-difluoro-2-hydroxycyclohexyl]carbamate. InChIKey: DQWDLJFIWPTHRH-NWDGAFQWSA-N.
| Molecular formula | C14H17F2NO3 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | benzyl N-[(1S,2R)-3,3-difluoro-2-hydroxycyclohexyl]carbamate |
| InChIKey | DQWDLJFIWPTHRH-NWDGAFQWSA-N |
| SMILES | C1C[C@@H]([C@H](C(C1)(F)F)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)