CAS 1932776-83-4 is the registry number for Cis-benzyl 3-fluoro-4-(fluoromethyl)-4-hydroxypiperidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.
Benzyl (3S,4S)-3-fluoro-4-(fluoromethyl)-4-hydroxypiperidine-1-carboxylate (CAS 1932776-83-4) is a chemical compound with the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. IUPAC name: benzyl (3S,4S)-3-fluoro-4-(fluoromethyl)-4-hydroxypiperidine-1-carboxylate. InChIKey: FDMJTUQOQPSWKN-JSGCOSHPSA-N.
| Molecular formula | C14H17F2NO3 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | benzyl (3S,4S)-3-fluoro-4-(fluoromethyl)-4-hydroxypiperidine-1-carboxylate |
| InChIKey | FDMJTUQOQPSWKN-JSGCOSHPSA-N |
| SMILES | C1CN(C[C@@H]([C@]1(CF)O)F)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)