Products 1227628-99-0
CAS 1227628-99-0 is the registry number for Methyl 2-(Bromomethyl)Benzo[D]Thiazole-5-Carboxylate, ≥95%. Offered by: Chemat. Available pack sizes: 100mg.
Methyl 2-(bromomethyl)-1,3-benzothiazole-5-carboxylate (CAS 1227628-99-0) is a chemical compound with the molecular formula C10H8BrNO2S and a molecular weight of 286.15 g/mol. IUPAC name: methyl 2-(bromomethyl)-1,3-benzothiazole-5-carboxylate. InChIKey: DODWLYJDVXHYMC-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2S |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | methyl 2-(bromomethyl)-1,3-benzothiazole-5-carboxylate |
| InChIKey | DODWLYJDVXHYMC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)SC(=N2)CBr |
Computed by PubChem (NCBI)