CAS 1227694-88-3 appears in our catalog under these names: (E)–N–(3–(3–(Dimethylamino)acryloyl)phenyl)–N–methylacetamide, (E)-N-(3-(3-(Dimethylamino)acryloyl)phenyl)-N-methylacetamide, 95%. Offered by: GLPBio, AmBeed. Available pack sizes: 1g, 250mg.
N-[3-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]-N-methylacetamide (CAS 1227694-88-3) is a chemical compound with the molecular formula C14H18N2O2 and a molecular weight of 246.30 g/mol. IUPAC name: N-[3-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]-N-methylacetamide. InChIKey: CWHTXVLCGAQQRA-CMDGGOBGSA-N.
| Molecular formula | C14H18N2O2 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | N-[3-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]-N-methylacetamide |
| InChIKey | CWHTXVLCGAQQRA-CMDGGOBGSA-N |
| SMILES | CC(=O)N(C)C1=CC=CC(=C1)C(=O)/C=C/N(C)C |
Computed by PubChem (NCBI)