CAS 96605-65-1 is the registry number for N-(3-(3-(Dimethylamino)acryloyl)phenyl)-n-methylacetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g, 100mg.
N-[3-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]-N-methylacetamide (CAS 96605-65-1) is a chemical compound with the molecular formula C14H18N2O2 and a molecular weight of 246.30 g/mol. IUPAC name: N-[3-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]-N-methylacetamide. InChIKey: CWHTXVLCGAQQRA-CMDGGOBGSA-N.
| Molecular formula | C14H18N2O2 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | N-[3-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]-N-methylacetamide |
| InChIKey | CWHTXVLCGAQQRA-CMDGGOBGSA-N |
| SMILES | CC(=O)N(C)C1=CC=CC(=C1)C(=O)/C=C/N(C)C |
Computed by PubChem (NCBI)