CAS 1269504-26-8 appears in our catalog under these names: (S)–4–(1–Aminoethyl)–N,N–dimethylbenzenamine dihydrochloride, (S)-4-(1-Aminoethyl)-N,N-dimethylbenzenamine dihydrochloride, 95%, 95%, (S)-4-(1-Aminoethyl)-N,N-dimethylbenzenamine dihydrochloride, 95%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 50mg, 1g.
4-[(1S)-1-aminoethyl]-N,N-dimethylaniline;dihydrochloride (CAS 1269504-26-8) is a chemical compound with the molecular formula C10H18Cl2N2 and a molecular weight of 237.17 g/mol. IUPAC name: 4-[(1S)-1-aminoethyl]-N,N-dimethylaniline;dihydrochloride. InChIKey: ISKBUIGUNHZFKY-JZGIKJSDSA-N.
| Molecular formula | C10H18Cl2N2 |
|---|---|
| Molecular weight | 237.17 g/mol |
| IUPAC name | 4-[(1S)-1-aminoethyl]-N,N-dimethylaniline;dihydrochloride |
| InChIKey | ISKBUIGUNHZFKY-JZGIKJSDSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)N(C)C)N.Cl.Cl |
Computed by PubChem (NCBI)