Products 1228009-58-2
CAS 1228009-58-2 is the registry number for 8-Chloro-4-fluoro-3-hydroxy-1,6-naphthyridin-2(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-4-fluoro-3-hydroxy-1H-1,6-naphthyridin-2-one (CAS 1228009-58-2) is a chemical compound with the molecular formula C8H4ClFN2O2 and a molecular weight of 214.58 g/mol. IUPAC name: 8-chloro-4-fluoro-3-hydroxy-1H-1,6-naphthyridin-2-one. InChIKey: OCPOFPUZJQOMCK-UHFFFAOYSA-N.
| Molecular formula | C8H4ClFN2O2 |
|---|---|
| Molecular weight | 214.58 g/mol |
| IUPAC name | 8-chloro-4-fluoro-3-hydroxy-1H-1,6-naphthyridin-2-one |
| InChIKey | OCPOFPUZJQOMCK-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C=N1)Cl)NC(=O)C(=C2F)O |
Computed by PubChem (NCBI)