CAS 1343830-70-5 is the registry number for 3-(3-Chloro-4-fluorophenyl)-4,5-dihydro-1,2,4-oxadiazol-5-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-(3-chloro-4-fluorophenyl)-4H-1,2,4-oxadiazol-5-one (CAS 1343830-70-5) is a chemical compound with the molecular formula C8H4ClFN2O2 and a molecular weight of 214.58 g/mol. IUPAC name: 3-(3-chloro-4-fluorophenyl)-4H-1,2,4-oxadiazol-5-one. InChIKey: XGEOHOUCXQNHEM-UHFFFAOYSA-N.
| Molecular formula | C8H4ClFN2O2 |
|---|---|
| Molecular weight | 214.58 g/mol |
| IUPAC name | 3-(3-chloro-4-fluorophenyl)-4H-1,2,4-oxadiazol-5-one |
| InChIKey | XGEOHOUCXQNHEM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NOC(=O)N2)Cl)F |
Computed by PubChem (NCBI)