CAS 1342016-50-5 is the registry number for 5-(4-Chloro-2-fluorophenyl)-3H-1,3,4-oxadiazol-2-one, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-(4-chloro-2-fluorophenyl)-3H-1,3,4-oxadiazol-2-one (CAS 1342016-50-5) is a chemical compound with the molecular formula C8H4ClFN2O2 and a molecular weight of 214.58 g/mol. IUPAC name: 5-(4-chloro-2-fluorophenyl)-3H-1,3,4-oxadiazol-2-one. InChIKey: WGUBEIDBGZJJNX-UHFFFAOYSA-N.
| Molecular formula | C8H4ClFN2O2 |
|---|---|
| Molecular weight | 214.58 g/mol |
| IUPAC name | 5-(4-chloro-2-fluorophenyl)-3H-1,3,4-oxadiazol-2-one |
| InChIKey | WGUBEIDBGZJJNX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)F)C2=NNC(=O)O2 |
Computed by PubChem (NCBI)