CAS 2763157-75-9 is the registry number for 7-Chloro-8-fluoro-1,6-naphthyridine-2,4-diol, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg.
7-chloro-8-fluoro-4-hydroxy-1H-1,6-naphthyridin-2-one (CAS 2763157-75-9) is a chemical compound with the molecular formula C8H4ClFN2O2 and a molecular weight of 214.58 g/mol. IUPAC name: 7-chloro-8-fluoro-4-hydroxy-1H-1,6-naphthyridin-2-one. InChIKey: RGNTYGHUSLOVOI-UHFFFAOYSA-N.
| Molecular formula | C8H4ClFN2O2 |
|---|---|
| Molecular weight | 214.58 g/mol |
| IUPAC name | 7-chloro-8-fluoro-4-hydroxy-1H-1,6-naphthyridin-2-one |
| InChIKey | RGNTYGHUSLOVOI-UHFFFAOYSA-N |
| SMILES | C1=C(C2=CN=C(C(=C2NC1=O)F)Cl)O |
Computed by PubChem (NCBI)