Products 885521-61-9
CAS 885521-61-9 appears in our catalog under these names: 3-Chloro-4-fluoro-1H-indazole-6-carboxylic acid, 95%, 95%, 3-Chloro-4-fluoro-1H-indazole-6-carboxylic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-chloro-4-fluoro-2H-indazole-6-carboxylic acid (CAS 885521-61-9) is a chemical compound with the molecular formula C8H4ClFN2O2 and a molecular weight of 214.58 g/mol. IUPAC name: 3-chloro-4-fluoro-2H-indazole-6-carboxylic acid. InChIKey: DSANVVGFCFMLEL-UHFFFAOYSA-N.
| Molecular formula | C8H4ClFN2O2 |
|---|---|
| Molecular weight | 214.58 g/mol |
| IUPAC name | 3-chloro-4-fluoro-2H-indazole-6-carboxylic acid |
| InChIKey | DSANVVGFCFMLEL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C(NN=C21)Cl)F)C(=O)O |
Computed by PubChem (NCBI)