Products 1228376-15-5
CAS 1228376-15-5 appears in our catalog under these names: Ethyl 3-chloro-4-cyanobenzoate, 95%, Ethyl 3-chloro-4-cyanobenzoate, 95+%, Ethyl 3-chloro-4-cyanobenzoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 0,5g, 50mg.
Ethyl 3-chloro-4-cyanobenzoate (CAS 1228376-15-5) is a chemical compound with the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. IUPAC name: ethyl 3-chloro-4-cyanobenzoate. InChIKey: YWKJUFOBOSEUFR-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | ethyl 3-chloro-4-cyanobenzoate |
| InChIKey | YWKJUFOBOSEUFR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)C#N)Cl |
Computed by PubChem (NCBI)