Products 15936-74-0
CAS 15936-74-0 appears in our catalog under these names: 5-Chloro-7-methyl-1H-indole-2-carboxylic acid, 97%, 5-Chloro-7-methyl-1h-indole-2-carboxylic acid 95%, 5-Chloro-7-methyl-1h-indole-2-carboxylic acid, 98%, 98%, 5-chloro-7-methyl-1H-indole-2-carboxylic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100mg, 2.5g.
5-chloro-7-methyl-1H-indole-2-carboxylic acid (CAS 15936-74-0) is a chemical compound with the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. IUPAC name: 5-chloro-7-methyl-1H-indole-2-carboxylic acid. InChIKey: KCHVBNGYTXIUNL-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 5-chloro-7-methyl-1H-indole-2-carboxylic acid |
| InChIKey | KCHVBNGYTXIUNL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)