Products 1379362-81-8
CAS 1379362-81-8 appears in our catalog under these names: 6-Chloro-5-ethyl-2,3-dihydro-1h-indole-2,3-dione, 95%, 6-Chloro-5-ethylisatin, 6-Chloro-5-ethylisatin, min. 95 %, 50 mg, 6-Chloro-5-ethylisatin, min. 95 %, 100 mg, 6-Chloro-5-ethylisatin, min. 95 %, 250 mg. Offered by: Combi-blocks, Biosynth, Roth. Available pack sizes: 100mg, 1g, 250mg, 500mg, 1000mg, 50mg.
6-chloro-5-ethyl-1H-indole-2,3-dione (CAS 1379362-81-8) is a chemical compound with the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. IUPAC name: 6-chloro-5-ethyl-1H-indole-2,3-dione. InChIKey: CYICFPMUMCXPOH-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 6-chloro-5-ethyl-1H-indole-2,3-dione |
| InChIKey | CYICFPMUMCXPOH-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1Cl)NC(=O)C2=O |
Computed by PubChem (NCBI)