Products 16381-48-9
CAS 16381-48-9 appears in our catalog under these names: 7-Chloro-3-methyl-1h-indole-2-carboxylic acid, 95%, 7-Chloro-3-methyl-1H-indole-2-carboxylic acid, 7-Chloro-3-methyl-1H-indole-2-carboxylic acid 97%, 7-Chloro-3-methyl-1H-indole-2-carboxylic acid, 97%, 97%, 7-Chloro-3-methyl-1h-indole-2-carboxylic acid, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 0,5g, 5g, 100mg, 500mg.
7-chloro-3-methyl-1H-indole-2-carboxylic acid (CAS 16381-48-9) is a chemical compound with the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. IUPAC name: 7-chloro-3-methyl-1H-indole-2-carboxylic acid. InChIKey: UJVTZVNZWSRCNL-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 7-chloro-3-methyl-1H-indole-2-carboxylic acid |
| InChIKey | UJVTZVNZWSRCNL-UHFFFAOYSA-N |
| SMILES | CC1=C(NC2=C1C=CC=C2Cl)C(=O)O |
Computed by PubChem (NCBI)