CAS 1379340-45-0 appears in our catalog under these names: 4-Chloro-5-ethylisatin, 95%, 4-Chloro-5-ethylisatin. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg.
4-chloro-5-ethyl-1H-indole-2,3-dione (CAS 1379340-45-0) is a chemical compound with the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. IUPAC name: 4-chloro-5-ethyl-1H-indole-2,3-dione. InChIKey: RDLUZLZDIZMWFM-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 4-chloro-5-ethyl-1H-indole-2,3-dione |
| InChIKey | RDLUZLZDIZMWFM-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=C(C=C1)NC(=O)C2=O)Cl |
Computed by PubChem (NCBI)