Products 1228506-95-3
CAS 1228506-95-3 is the registry number for 2-Bromo-n-(2,4-difluorobenzyl)acetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-bromo-N-[(2,4-difluorophenyl)methyl]acetamide (CAS 1228506-95-3) is a chemical compound with the molecular formula C9H8BrF2NO and a molecular weight of 264.07 g/mol. IUPAC name: 2-bromo-N-[(2,4-difluorophenyl)methyl]acetamide. InChIKey: QFASOSRYKBQJCH-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF2NO |
|---|---|
| Molecular weight | 264.07 g/mol |
| IUPAC name | 2-bromo-N-[(2,4-difluorophenyl)methyl]acetamide |
| InChIKey | QFASOSRYKBQJCH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)CNC(=O)CBr |
Computed by PubChem (NCBI)