Products 1872076-32-8
CAS 1872076-32-8 is the registry number for 4-Bromo-3-fluoro-n-(2-fluoro-ethyl)-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-bromo-3-fluoro-N-(2-fluoroethyl)benzamide (CAS 1872076-32-8) is a chemical compound with the molecular formula C9H8BrF2NO and a molecular weight of 264.07 g/mol. IUPAC name: 4-bromo-3-fluoro-N-(2-fluoroethyl)benzamide. InChIKey: JJRRBCRYIMGIMT-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF2NO |
|---|---|
| Molecular weight | 264.07 g/mol |
| IUPAC name | 4-bromo-3-fluoro-N-(2-fluoroethyl)benzamide |
| InChIKey | JJRRBCRYIMGIMT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)NCCF)F)Br |
Computed by PubChem (NCBI)