CAS 2504203-48-7 is the registry number for 5-Bromo-n-ethyl-2,4-difluorobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-bromo-N-ethyl-2,4-difluorobenzamide (CAS 2504203-48-7) is a chemical compound with the molecular formula C9H8BrF2NO and a molecular weight of 264.07 g/mol. IUPAC name: 5-bromo-N-ethyl-2,4-difluorobenzamide. InChIKey: KQBQNXDQKLEDGG-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF2NO |
|---|---|
| Molecular weight | 264.07 g/mol |
| IUPAC name | 5-bromo-N-ethyl-2,4-difluorobenzamide |
| InChIKey | KQBQNXDQKLEDGG-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=CC(=C(C=C1F)F)Br |
Computed by PubChem (NCBI)