Products 2647887-76-9
CAS 2647887-76-9 is the registry number for N-(3-Bromo-5-(difluoromethyl)phenyl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[3-bromo-5-(difluoromethyl)phenyl]acetamide (CAS 2647887-76-9) is a chemical compound with the molecular formula C9H8BrF2NO and a molecular weight of 264.07 g/mol. IUPAC name: N-[3-bromo-5-(difluoromethyl)phenyl]acetamide. InChIKey: VXVLQFHXYQSJGJ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF2NO |
|---|---|
| Molecular weight | 264.07 g/mol |
| IUPAC name | N-[3-bromo-5-(difluoromethyl)phenyl]acetamide |
| InChIKey | VXVLQFHXYQSJGJ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=CC(=C1)C(F)F)Br |
Computed by PubChem (NCBI)