CAS 1449008-10-9 appears in our catalog under these names: 4-Bromo-2,5-difluoro-n,n-dimethylbenzamide, 95%, 4-Bromo-2,5-difluoro-N,N-dimethylbenzamide, ≥95%, ≥95%, 4-Bromo-2,5-difluoro-N,N-dimethylbenzamide. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
4-bromo-2,5-difluoro-N,N-dimethylbenzamide (CAS 1449008-10-9) is a chemical compound with the molecular formula C9H8BrF2NO and a molecular weight of 264.07 g/mol. IUPAC name: 4-bromo-2,5-difluoro-N,N-dimethylbenzamide. InChIKey: JUVITWPWCGJPLT-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF2NO |
|---|---|
| Molecular weight | 264.07 g/mol |
| IUPAC name | 4-bromo-2,5-difluoro-N,N-dimethylbenzamide |
| InChIKey | JUVITWPWCGJPLT-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=C(C=C1F)Br)F |
Computed by PubChem (NCBI)