CAS 1228550-13-7 is the registry number for 5,6-Di(meth-d3-oxy)-1-indanone. Offered by: TRC. Available pack sizes: 100mg.
5,6-bis(trideuteriomethoxy)-2,3-dihydroinden-1-one (CAS 1228550-13-7) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 198.25 g/mol. IUPAC name: 5,6-bis(trideuteriomethoxy)-2,3-dihydroinden-1-one. InChIKey: IHMQOBPGHZFGLC-WFGJKAKNSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 198.25 g/mol |
| IUPAC name | 5,6-bis(trideuteriomethoxy)-2,3-dihydroinden-1-one |
| InChIKey | IHMQOBPGHZFGLC-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C2C(=C1)CCC2=O)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)