Products 1228590-23-5
CAS 1228590-23-5 is the registry number for 3,7,2',4',5'-Pentamethoxyflavone. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
3,7-dimethoxy-2-(2,4,5-trimethoxyphenyl)chromen-4-one (CAS 1228590-23-5) is a chemical compound with the molecular formula C20H20O7 and a molecular weight of 372.4 g/mol. IUPAC name: 3,7-dimethoxy-2-(2,4,5-trimethoxyphenyl)chromen-4-one. InChIKey: HWCMJLHSVXCCRZ-UHFFFAOYSA-N.
| Molecular formula | C20H20O7 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | 3,7-dimethoxy-2-(2,4,5-trimethoxyphenyl)chromen-4-one |
| InChIKey | HWCMJLHSVXCCRZ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)C(=C(O2)C3=CC(=C(C=C3OC)OC)OC)OC |
Computed by PubChem (NCBI)