Products 1228675-28-2

CAS 1228675-28-2 is the registry number for 2-Benzyl 5-(tert-butyl) 2,5-diazabicyclo[4.1.0]heptane-2,5-dicarboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-O-benzyl 5-O-tert-butyl 2,5-diazabicyclo[4.1.0]heptane-2,5-dicarboxylate (CAS 1228675-28-2) is a chemical compound with the molecular formula C18H24N2O4 and a molecular weight of 332.4 g/mol. IUPAC name: 2-O-benzyl 5-O-tert-butyl 2,5-diazabicyclo[4.1.0]heptane-2,5-dicarboxylate. InChIKey: GPXQAXAPIPYNRF-UHFFFAOYSA-N.

Identity
Molecular formulaC18H24N2O4
Molecular weight332.4 g/mol
IUPAC name2-O-benzyl 5-O-tert-butyl 2,5-diazabicyclo[4.1.0]heptane-2,5-dicarboxylate
InChIKeyGPXQAXAPIPYNRF-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCN(C2C1C2)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)