Products 1228924-38-6
CAS 1228924-38-6 is the registry number for rac-(1R,2S)-2-(Pyridin-3-yl)cyclopropan-1-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Trans-(1R,2S)-2-pyridin-3-ylcyclopropan-1-amine;dihydrochloride (CAS 1228924-38-6) is a chemical compound with the molecular formula C8H12Cl2N2 and a molecular weight of 207.10 g/mol. IUPAC name: trans-(1R,2S)-2-pyridin-3-ylcyclopropan-1-amine;dihydrochloride. InChIKey: VXKOQFJNQOGBSM-OXOJUWDDSA-N.
| Molecular formula | C8H12Cl2N2 |
|---|---|
| Molecular weight | 207.10 g/mol |
| IUPAC name | trans-(1R,2S)-2-pyridin-3-ylcyclopropan-1-amine;dihydrochloride |
| InChIKey | VXKOQFJNQOGBSM-OXOJUWDDSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CN=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)