Products 1229-18-1
CAS 1229-18-1 is the registry number for Testosterone Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
(8R,9S,10R,13S)-10,13-dimethyl-2,6,7,8,9,11,12,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (CAS 1229-18-1) is a chemical compound with the molecular formula C19H24O2 and a molecular weight of 284.4 g/mol. IUPAC name: (8R,9S,10R,13S)-10,13-dimethyl-2,6,7,8,9,11,12,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione. InChIKey: OSXOREFWRGDSPZ-CBVHJVASSA-N.
| Molecular formula | C19H24O2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | (8R,9S,10R,13S)-10,13-dimethyl-2,6,7,8,9,11,12,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| InChIKey | OSXOREFWRGDSPZ-CBVHJVASSA-N |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2CC[C@]4(C3=CCC4=O)C |
Computed by PubChem (NCBI)