CAS 68969-90-4 appears in our catalog under these names: 4-Methylestrone, Estrone Impurity 19. Offered by: Chemat Brand, TRC, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 5mg, 50mg, 100mg, 200mg.
(8R,9S,13S,14S)-3-hydroxy-4,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (CAS 68969-90-4) is a chemical compound with the molecular formula C19H24O2 and a molecular weight of 284.4 g/mol. IUPAC name: (8R,9S,13S,14S)-3-hydroxy-4,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one. InChIKey: ZHKWXIUEKZTDQH-JEWRLFTDSA-N.
| Molecular formula | C19H24O2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | (8R,9S,13S,14S)-3-hydroxy-4,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| InChIKey | ZHKWXIUEKZTDQH-JEWRLFTDSA-N |
| SMILES | CC1=C(C=CC2=C1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CCC4=O)C)O |
Computed by PubChem (NCBI)