Products 68539-12-8
CAS 68539-12-8 appears in our catalog under these names: Androstenediol Impurity 3, Testosterone Impurity 4, Androsta-4,8-diene-3,17-dione. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
(10S,13S,14S)-10,13-dimethyl-2,6,7,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (CAS 68539-12-8) is a chemical compound with the molecular formula C19H24O2 and a molecular weight of 284.4 g/mol. IUPAC name: (10S,13S,14S)-10,13-dimethyl-2,6,7,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione. InChIKey: ZPXXTTSREWNDFF-SNRMKQJTSA-N.
| Molecular formula | C19H24O2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | (10S,13S,14S)-10,13-dimethyl-2,6,7,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| InChIKey | ZPXXTTSREWNDFF-SNRMKQJTSA-N |
| SMILES | C[C@]12CCC3=C([C@@H]1CCC2=O)CCC4=CC(=O)CC[C@@]43C |
Computed by PubChem (NCBI)