CAS 56531-57-8 appears in our catalog under these names: 3-(3,4-Dimethyl-phenyl)-adamantane-1-carboxylic acid, 95%, 3-(3,4-Dimethylphenyl)adamantane-1-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid (CAS 56531-57-8) is a chemical compound with the molecular formula C19H24O2 and a molecular weight of 284.4 g/mol. IUPAC name: 3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid. InChIKey: OSUAHUMJPBHFKV-UHFFFAOYSA-N.
| Molecular formula | C19H24O2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | 3-(3,4-dimethylphenyl)adamantane-1-carboxylic acid |
| InChIKey | OSUAHUMJPBHFKV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C23CC4CC(C2)CC(C4)(C3)C(=O)O)C |
Computed by PubChem (NCBI)