Products 17305-49-6
CAS 17305-49-6 appears in our catalog under these names: Testosterone Impurity 5, Androsta-4,8(14)-diene-3,17-dione. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg.
(9S,10R,13S)-10,13-dimethyl-2,6,7,9,11,12,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (CAS 17305-49-6) is a chemical compound with the molecular formula C19H24O2 and a molecular weight of 284.4 g/mol. IUPAC name: (9S,10R,13S)-10,13-dimethyl-2,6,7,9,11,12,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione. InChIKey: SGPDPQDGYFWQGO-WDSOQIARSA-N.
| Molecular formula | C19H24O2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | (9S,10R,13S)-10,13-dimethyl-2,6,7,9,11,12,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| InChIKey | SGPDPQDGYFWQGO-WDSOQIARSA-N |
| SMILES | C[C@]12CCC(=O)C=C1CCC3=C4CCC(=O)[C@]4(CC[C@H]23)C |
Computed by PubChem (NCBI)