CAS 1624-62-0 appears in our catalog under these names: 3-O-Methyl Estrone, 3-O-Methyl Estrone, >95% (HPLC), Estrone 3-Methyl Ether, Estrone 3–methyl ether, Estrone 3-Methyl Ether, >97.0%(HPLC). Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Biosynth. Available pack sizes: on request, 10g, 1g, 5g, 25mg, 100mg, 500mg, 25g.
(8R,9S,13S,14S)-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (CAS 1624-62-0) is a chemical compound with the molecular formula C19H24O2 and a molecular weight of 284.4 g/mol. IUPAC name: (8R,9S,13S,14S)-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one. InChIKey: BCWWDWHFBMPLFQ-VXNCWWDNSA-N.
| Molecular formula | C19H24O2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | (8R,9S,13S,14S)-3-methoxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| InChIKey | BCWWDWHFBMPLFQ-VXNCWWDNSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3C=CC(=C4)OC |
Computed by PubChem (NCBI)