Products 1229024-41-2

CAS 1229024-41-2 is the registry number for Ald-CH2-PEG2-NHBoc, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[2-[2-(2-oxoethoxy)ethoxy]ethyl]carbamate (CAS 1229024-41-2) is a chemical compound with the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. IUPAC name: tert-butyl N-[2-[2-(2-oxoethoxy)ethoxy]ethyl]carbamate. InChIKey: TWCFRDOVUYWAOH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H21NO5
Molecular weight247.29 g/mol
IUPAC nametert-butyl N-[2-[2-(2-oxoethoxy)ethoxy]ethyl]carbamate
InChIKeyTWCFRDOVUYWAOH-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCOCCOCC=O

Computed by PubChem (NCBI)