Products 1229394-75-5
CAS 1229394-75-5 appears in our catalog under these names: Fmoc-Abu(3-N3)-OH (2R,3R), Fmoc-Abu(3-N3) (2R,3R). Offered by: Iris Biotech, MedChemExpress. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg, Get quote.
(2R,3R)-3-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 1229394-75-5) is a chemical compound with the molecular formula C19H18N4O4 and a molecular weight of 366.4 g/mol. IUPAC name: (2R,3R)-3-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: LLJMYBCJYQGZOS-PIGZYNQJSA-N.
| Molecular formula | C19H18N4O4 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | (2R,3R)-3-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | LLJMYBCJYQGZOS-PIGZYNQJSA-N |
| SMILES | C[C@H]([C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)N=[N+]=[N-] |
Computed by PubChem (NCBI)