CAS 934502-72-4 appears in our catalog under these names: Fmoc-dbu(n3) (s), 95%, Fmoc-L-Dbu(N3)-OH. Offered by: Combi-blocks, Iris Biotech. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 500mg.
(3S)-4-azido-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 934502-72-4) is a chemical compound with the molecular formula C19H18N4O4 and a molecular weight of 366.4 g/mol. IUPAC name: (3S)-4-azido-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: PNIMZMLVZIUHAV-LBPRGKRZSA-N.
| Molecular formula | C19H18N4O4 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | (3S)-4-azido-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | PNIMZMLVZIUHAV-LBPRGKRZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC(=O)O)CN=[N+]=[N-] |
Computed by PubChem (NCBI)