CAS 146306-79-8 appears in our catalog under these names: (2S,3R)-2-(Fmoc-amino)-3-azidobutanoic acid, 95%, Fmoc-Abu(3-N3)-OH (2S,3R), (2S,3R)-Fmoc-Abu(3-N3)-OH, (2S,3R)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-azidobutanoic acid, 95%, 95%, (2S,3R)-(Fmoc-amino)-3-azidobutyric acid, 95%. Offered by: Combi-blocks, Iris Biotech, MedChemExpress, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 25mg, 50mg, 500mg, 5g, 1 g.
(2S,3R)-3-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 146306-79-8) is a chemical compound with the molecular formula C19H18N4O4 and a molecular weight of 366.4 g/mol. IUPAC name: (2S,3R)-3-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: LLJMYBCJYQGZOS-DIFFPNOSSA-N.
| Molecular formula | C19H18N4O4 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | (2S,3R)-3-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | LLJMYBCJYQGZOS-DIFFPNOSSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)N=[N+]=[N-] |
Computed by PubChem (NCBI)