CAS 1932023-47-6 is the registry number for Fmoc-D-Dbu(N3)-OH. Offered by: Iris Biotech, MedChemExpress. Available pack sizes: 1g, 5g, 250mg, 500mg, Get quote.
(3R)-4-azido-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 1932023-47-6) is a chemical compound with the molecular formula C19H18N4O4 and a molecular weight of 366.4 g/mol. IUPAC name: (3R)-4-azido-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: PNIMZMLVZIUHAV-GFCCVEGCSA-N.
| Molecular formula | C19H18N4O4 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | (3R)-4-azido-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | PNIMZMLVZIUHAV-GFCCVEGCSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC(=O)O)CN=[N+]=[N-] |
Computed by PubChem (NCBI)