CAS 131669-42-6 appears in our catalog under these names: (2S,3S)-Fmoc-abu(3-n3)-oh, 98%, Fmoc-Abu(3-N3)-OH (2S,3S). Offered by: Combi-blocks, Iris Biotech. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 500mg.
(2S,3S)-3-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 131669-42-6) is a chemical compound with the molecular formula C19H18N4O4 and a molecular weight of 366.4 g/mol. IUPAC name: (2S,3S)-3-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: LLJMYBCJYQGZOS-GTNSWQLSSA-N.
| Molecular formula | C19H18N4O4 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | (2S,3S)-3-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | LLJMYBCJYQGZOS-GTNSWQLSSA-N |
| SMILES | C[C@@H]([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)N=[N+]=[N-] |
Computed by PubChem (NCBI)