CAS 123019-95-4 is the registry number for Propanoic acid, 3-[(2-bromophenyl)amino]-3-oxo-, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(2-bromoanilino)-3-oxopropanoic acid (CAS 123019-95-4) is a chemical compound with the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. IUPAC name: 3-(2-bromoanilino)-3-oxopropanoic acid. InChIKey: JLSGNTVMVLHUOE-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO3 |
|---|---|
| Molecular weight | 258.07 g/mol |
| IUPAC name | 3-(2-bromoanilino)-3-oxopropanoic acid |
| InChIKey | JLSGNTVMVLHUOE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC(=O)CC(=O)O)Br |
Computed by PubChem (NCBI)