Products 123167-26-0
CAS 123167-26-0 appears in our catalog under these names: Arachidonic Acid–d5, Arachidonic acid-d5, Arachidonic acid-d5, 98.5%. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 100μg, 10mg, 5mg, 50mg, 25mg, 1 mg (32.31 mM * 100 μL in Ethanol).
(5Z,8Z,11Z,14Z)-19,19,20,20,20-pentadeuterioicosa-5,8,11,14-tetraenoic acid (CAS 123167-26-0) is a chemical compound with the molecular formula C20H32O2 and a molecular weight of 309.5 g/mol. IUPAC name: (5Z,8Z,11Z,14Z)-19,19,20,20,20-pentadeuterioicosa-5,8,11,14-tetraenoic acid. InChIKey: YZXBAPSDXZZRGB-QHIWQZJRSA-N.
| Molecular formula | C20H32O2 |
|---|---|
| Molecular weight | 309.5 g/mol |
| IUPAC name | (5Z,8Z,11Z,14Z)-19,19,20,20,20-pentadeuterioicosa-5,8,11,14-tetraenoic acid |
| InChIKey | YZXBAPSDXZZRGB-QHIWQZJRSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])CCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O |
Computed by PubChem (NCBI)