Products 2692624-40-9
CAS 2692624-40-9 is the registry number for Arachidonic acid-13C4, 95.0%. Offered by: MedChemExpress. Available pack sizes: 100 μg.
(5Z,8Z,11Z,14Z)-(2,3,4,5-13C4)icosa-5,8,11,14-tetraenoic acid (CAS 2692624-40-9) is a chemical compound with the molecular formula C20H32O2 and a molecular weight of 308.44 g/mol. IUPAC name: (5Z,8Z,11Z,14Z)-(2,3,4,5-13C4)icosa-5,8,11,14-tetraenoic acid. InChIKey: YZXBAPSDXZZRGB-ARTDLICJSA-N.
| Molecular formula | C20H32O2 |
|---|---|
| Molecular weight | 308.44 g/mol |
| IUPAC name | (5Z,8Z,11Z,14Z)-(2,3,4,5-13C4)icosa-5,8,11,14-tetraenoic acid |
| InChIKey | YZXBAPSDXZZRGB-ARTDLICJSA-N |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=[13CH]\[13CH2][13CH2][13CH2]C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Arachidonic acid-13C4, orb3138447