CAS 2692624-11-4 appears in our catalog under these names: Arachidonic Acid–d11, Arachidonic acid-d11, 98.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 100μg, 250μg, 500μg, 100 μg (3.17 mM * 100 μL in Ethanol), 1 mg (3.17 mM * 1 mL in Ethanol), 500 μg (3.17 mM * 500 μL in Ethanol).
(5Z,8Z,11Z,14Z)-16,16,17,17,18,18,19,19,20,20,20-undecadeuterioicosa-5,8,11,14-tetraenoic acid (CAS 2692624-11-4) is a chemical compound with the molecular formula C20H32O2 and a molecular weight of 315.5 g/mol. IUPAC name: (5Z,8Z,11Z,14Z)-16,16,17,17,18,18,19,19,20,20,20-undecadeuterioicosa-5,8,11,14-tetraenoic acid. InChIKey: YZXBAPSDXZZRGB-MBZQHBQHSA-N.
| Molecular formula | C20H32O2 |
|---|---|
| Molecular weight | 315.5 g/mol |
| IUPAC name | (5Z,8Z,11Z,14Z)-16,16,17,17,18,18,19,19,20,20,20-undecadeuterioicosa-5,8,11,14-tetraenoic acid |
| InChIKey | YZXBAPSDXZZRGB-MBZQHBQHSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O |
Computed by PubChem (NCBI)