CAS 1231944-64-1 is the registry number for 3-Acetyl-4-hydroxy-5,6-dimethoxy-1,2-dihydropyridin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-acetyl-4-hydroxy-5,6-dimethoxy-1H-pyridin-2-one (CAS 1231944-64-1) is a chemical compound with the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. IUPAC name: 3-acetyl-4-hydroxy-5,6-dimethoxy-1H-pyridin-2-one. InChIKey: DOSULXUPKLKWQH-UHFFFAOYSA-N.
| Molecular formula | C9H11NO5 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 3-acetyl-4-hydroxy-5,6-dimethoxy-1H-pyridin-2-one |
| InChIKey | DOSULXUPKLKWQH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(NC1=O)OC)OC)O |
Computed by PubChem (NCBI)