CAS 1232365-58-0 appears in our catalog under these names: (S)-2-((tert-Butoxycarbonyl)amino)-3-(1-methylcyclobutyl)propanoic acid, 98%, (S)-2-((tert-Butoxycarbonyl)amino)-3-(1-methylcyclobutyl)propanoic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
(2S)-3-(1-methylcyclobutyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1232365-58-0) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: (2S)-3-(1-methylcyclobutyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: ATLGJNSAMLEGKP-VIFPVBQESA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | (2S)-3-(1-methylcyclobutyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | ATLGJNSAMLEGKP-VIFPVBQESA-N |
| SMILES | CC1(CCC1)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)