Products 1232688-41-3
CAS 1232688-41-3 is the registry number for 1-Bromo-2-isocyanato-4,5-dimethoxybenzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-bromo-2-isocyanato-4,5-dimethoxybenzene (CAS 1232688-41-3) is a chemical compound with the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. IUPAC name: 1-bromo-2-isocyanato-4,5-dimethoxybenzene. InChIKey: VOCXTMLNZYVNJB-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO3 |
|---|---|
| Molecular weight | 258.07 g/mol |
| IUPAC name | 1-bromo-2-isocyanato-4,5-dimethoxybenzene |
| InChIKey | VOCXTMLNZYVNJB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)N=C=O)Br)OC |
Computed by PubChem (NCBI)