Products 123278-01-3
CAS 123278-01-3 appears in our catalog under these names: 4'–Methoxyagarotetrol, 4'-methoxyagarotetrol, ≥98%, ≥98%, 4'-Methoxyagarotetrol, 93.17%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 20mg, 50mg, 1 mg, 5 mg, 10 mg.
(5S,6R,7R,8S)-5,6,7,8-tetrahydroxy-2-[2-(4-methoxyphenyl)ethyl]-5,6,7,8-tetrahydrochromen-4-one (CAS 123278-01-3) is a chemical compound with the molecular formula C18H20O7 and a molecular weight of 348.3 g/mol. IUPAC name: (5S,6R,7R,8S)-5,6,7,8-tetrahydroxy-2-[2-(4-methoxyphenyl)ethyl]-5,6,7,8-tetrahydrochromen-4-one. InChIKey: NRDKOXSXHXTKHR-HZMVEIRTSA-N.
| Molecular formula | C18H20O7 |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | (5S,6R,7R,8S)-5,6,7,8-tetrahydroxy-2-[2-(4-methoxyphenyl)ethyl]-5,6,7,8-tetrahydrochromen-4-one |
| InChIKey | NRDKOXSXHXTKHR-HZMVEIRTSA-N |
| SMILES | COC1=CC=C(C=C1)CCC2=CC(=O)C3=C(O2)[C@H]([C@@H]([C@@H]([C@H]3O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
4'-Methoxyagarotetrol, orb1684846