Products 89560-97-4
CAS 89560-97-4 appears in our catalog under these names: t–OMe–Byakangelicin, (R)-9-(2-Hydroxy-3-methoxy-3-methylbutoxy)-4-methoxy-7H-furo[3,2-g]chromen-7-one, ≥98%, ≥98%, (R)-tert-OMe-byakangelicin. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 5 mg, 10 mg, 1 mg.
9-[(2R)-2-hydroxy-3-methoxy-3-methylbutoxy]-4-methoxyfuro[3,2-g]chromen-7-one (CAS 89560-97-4) is a chemical compound with the molecular formula C18H20O7 and a molecular weight of 348.3 g/mol. IUPAC name: 9-[(2R)-2-hydroxy-3-methoxy-3-methylbutoxy]-4-methoxyfuro[3,2-g]chromen-7-one. InChIKey: SCGNAXSXMSFZME-GFCCVEGCSA-N.
| Molecular formula | C18H20O7 |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | 9-[(2R)-2-hydroxy-3-methoxy-3-methylbutoxy]-4-methoxyfuro[3,2-g]chromen-7-one |
| InChIKey | SCGNAXSXMSFZME-GFCCVEGCSA-N |
| SMILES | CC(C)([C@@H](COC1=C2C(=C(C3=C1OC(=O)C=C3)OC)C=CO2)O)OC |
Computed by PubChem (NCBI)