Products 79638-04-3
CAS 79638-04-3 appears in our catalog under these names: tert–OMe–byakangelicin, tert-OMe-byakangelicin. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg.
9-(2-hydroxy-3-methoxy-3-methylbutoxy)-4-methoxyfuro[3,2-g]chromen-7-one (CAS 79638-04-3) is a chemical compound with the molecular formula C18H20O7 and a molecular weight of 348.3 g/mol. IUPAC name: 9-(2-hydroxy-3-methoxy-3-methylbutoxy)-4-methoxyfuro[3,2-g]chromen-7-one. InChIKey: SCGNAXSXMSFZME-UHFFFAOYSA-N.
| Molecular formula | C18H20O7 |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | 9-(2-hydroxy-3-methoxy-3-methylbutoxy)-4-methoxyfuro[3,2-g]chromen-7-one |
| InChIKey | SCGNAXSXMSFZME-UHFFFAOYSA-N |
| SMILES | CC(C)(C(COC1=C2C(=C(C3=C1OC(=O)C=C3)OC)C=CO2)O)OC |
Computed by PubChem (NCBI)
Synonyms:
tert-OMe-byakangelicin, orb1943750