Products 1404479-46-4
CAS 1404479-46-4 appears in our catalog under these names: Aquilarone C, Aquilarone C, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: 1 mg, 5 mg, 5mg, 10mg, 20mg.
(5S,6S,7S,8R)-5,6,7,8-tetrahydroxy-2-[2-(4-methoxyphenyl)ethyl]-5,6,7,8-tetrahydrochromen-4-one (CAS 1404479-46-4) is a chemical compound with the molecular formula C18H20O7 and a molecular weight of 348.3 g/mol. IUPAC name: (5S,6S,7S,8R)-5,6,7,8-tetrahydroxy-2-[2-(4-methoxyphenyl)ethyl]-5,6,7,8-tetrahydrochromen-4-one. InChIKey: NRDKOXSXHXTKHR-LUKYLMHMSA-N.
| Molecular formula | C18H20O7 |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | (5S,6S,7S,8R)-5,6,7,8-tetrahydroxy-2-[2-(4-methoxyphenyl)ethyl]-5,6,7,8-tetrahydrochromen-4-one |
| InChIKey | NRDKOXSXHXTKHR-LUKYLMHMSA-N |
| SMILES | COC1=CC=C(C=C1)CCC2=CC(=O)C3=C(O2)[C@@H]([C@H]([C@H]([C@H]3O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Aquilarone C, orb1941791