Products 2893884-59-6

CAS 2893884-59-6 is the registry number for 2-(Benzyloxy)-4,6-bis(methoxymethoxy)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,4-bis(methoxymethoxy)-6-phenylmethoxybenzoic acid (CAS 2893884-59-6) is a chemical compound with the molecular formula C18H20O7 and a molecular weight of 348.3 g/mol. IUPAC name: 2,4-bis(methoxymethoxy)-6-phenylmethoxybenzoic acid. InChIKey: SKICJJNCQRTAJL-UHFFFAOYSA-N.

Identity
Molecular formulaC18H20O7
Molecular weight348.3 g/mol
IUPAC name2,4-bis(methoxymethoxy)-6-phenylmethoxybenzoic acid
InChIKeySKICJJNCQRTAJL-UHFFFAOYSA-N
SMILESCOCOC1=CC(=C(C(=C1)OCOC)C(=O)O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)