CAS 1233086-44-6 is the registry number for 1-tert-Butyl 2-ethyl 5-methyl-1H-indole-1,2-dicarboxylate, 98+%. Offered by: AmBeed. Available pack sizes: 1g.
1-O-tert-butyl 2-O-ethyl 5-methylindole-1,2-dicarboxylate (CAS 1233086-44-6) is a chemical compound with the molecular formula C17H21NO4 and a molecular weight of 303.35 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl 5-methylindole-1,2-dicarboxylate. InChIKey: GTUBBFJXLFYUAS-UHFFFAOYSA-N.
| Molecular formula | C17H21NO4 |
|---|---|
| Molecular weight | 303.35 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-ethyl 5-methylindole-1,2-dicarboxylate |
| InChIKey | GTUBBFJXLFYUAS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1C(=O)OC(C)(C)C)C=CC(=C2)C |
Computed by PubChem (NCBI)